C18H17N5O2S — CID 155547285
5-amino-N-[(4-methoxyphenyl)methyl]-7-methyl-3-thia-1,10,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide (PubChem CID 155547285) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is 5-amino-N-[(4-methoxyphenyl)methyl]-7-methyl-3-thia-1,10,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide.
| Compound Name | 5-amino-N-[(4-methoxyphenyl)methyl]-7-methyl-3-thia-1,10,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 155547285 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5-amino-N-[(4-methoxyphenyl)methyl]-7-methyl-3-thia-1,10,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2sc3c(c(C)cc4ncnn43)c2N)cc1 |
| InChI | InChI=1S/C18H17N5O2S/c1-10-7-13-21-9-22-23(13)18-14(10)15(19)16(26-18)17(24)20-8-11-3-5-12(25-2)6-4-11/h3-7,9H,8,19H2,1-2H3,(H,20,24) |
| InChIKey | LHLOJCZIPPOOFM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |