C28H21N5O3S — CID 155547306
5-methyl-2-(4-methylphenyl)-4-[4-(2-oxochromen-3-yl)-2-phenylimino-1,3-thiazol-3-yl]-1,2,4-triazol-3-one (PubChem CID 155547306) has the molecular formula C28H21N5O3S and a molecular weight of 507.58 g/mol. Its IUPAC name is 5-methyl-2-(4-methylphenyl)-4-[4-(2-oxochromen-3-yl)-2-phenylimino-1,3-thiazol-3-yl]-1,2,4-triazol-3-one.
| Compound Name | 5-methyl-2-(4-methylphenyl)-4-[4-(2-oxochromen-3-yl)-2-phenylimino-1,3-thiazol-3-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155547306 |
| Molecular Formula | C28H21N5O3S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 5-methyl-2-(4-methylphenyl)-4-[4-(2-oxochromen-3-yl)-2-phenylimino-1,3-thiazol-3-yl]-1,2,4-triazol-3-one |
| SMILES | Cc1ccc(-n2nc(C)n(-n3c(-c4cc5ccccc5oc4=O)cs/c3=N\c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C28H21N5O3S/c1-18-12-14-22(15-13-18)31-28(35)32(19(2)30-31)33-24(17-37-27(33)29-21-9-4-3-5-10-21)23-16-20-8-6-7-11-25(20)36-26(23)34/h3-17H,1-2H3/b29-27- |
| InChIKey | BLDALFKKQFHDKY-OHYPFYFLSA-N |
| XLogP | 4.83 |
| TPSA | 87.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|