C24H37ClN2O8 — CID 155547459
[(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-[(2R,3S,6R)-6-hydroxy-2-methyloxan-3-yl]oxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 4-chloro-1H-pyrrole-2-carboxylate (PubChem CID 155547459) has the molecular formula C24H37ClN2O8 and a molecular weight of 517.02 g/mol. Its IUPAC name is [(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-[(2R,3S,6R)-6-hydroxy-2-methyloxan-3-yl]oxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 4-chloro-1H-pyrrole-2-carboxylate.
| Compound Name | [(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-[(2R,3S,6R)-6-hydroxy-2-methyloxan-3-yl]oxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 4-chloro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 155547459 |
| Molecular Formula | C24H37ClN2O8 |
| Molecular Weight | 517.02 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | [(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-[(2R,3S,6R)-6-hydroxy-2-methyloxan-3-yl]oxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 4-chloro-1H-pyrrole-2-carboxylate |
| SMILES | C[C@@H]1O[C@H](O[C@H]2CC[C@H](O)O[C@@H]2C)C[C@@](C)(N)[C@H]1O[C@H]1CC[C@H](OC(=O)c2cc(Cl)c[nH]2)[C@@H](C)O1 |
| InChI | InChI=1S/C24H37ClN2O8/c1-12-17(5-7-19(28)30-12)33-21-10-24(4,26)22(14(3)32-21)35-20-8-6-18(13(2)31-20)34-23(29)16-9-15(25)11-27-16/h9,11-14,17-22,27-28H,5-8,10,26H2,1-4H3/t12-,13-,14+,17+,18+,19-,20+,21-,22+,24-/m1/s1 |
| InChIKey | HVYWTUZRQUODLW-GMKIRKNXSA-N |
| XLogP | 2.86 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.02 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |