C9H11N7O3S — CID 155547507
4-[5-amino-3-(hydrazinecarbonyl)-1,2,4-triazol-1-yl]benzenesulfonamide (PubChem CID 155547507) has the molecular formula C9H11N7O3S and a molecular weight of 297.30 g/mol. Its IUPAC name is 4-[5-amino-3-(hydrazinecarbonyl)-1,2,4-triazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[5-amino-3-(hydrazinecarbonyl)-1,2,4-triazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 155547507 |
| Molecular Formula | C9H11N7O3S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-[5-amino-3-(hydrazinecarbonyl)-1,2,4-triazol-1-yl]benzenesulfonamide |
| SMILES | NNC(=O)c1nc(N)n(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C9H11N7O3S/c10-9-13-7(8(17)14-11)15-16(9)5-1-3-6(4-2-5)20(12,18)19/h1-4H,11H2,(H,14,17)(H2,10,13,15)(H2,12,18,19) |
| InChIKey | FTVGYRWDFYHZKI-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 172.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|