C40H36N4O6 — CID 155547569
4-[3-[15-[3-(3-carboxypropoxy)phenyl]-2,3,22,24-tetrahydroporphyrin-5-yl]phenoxy]butanoic acid (PubChem CID 155547569) has the molecular formula C40H36N4O6 and a molecular weight of 668.75 g/mol. Its IUPAC name is 4-[3-[15-[3-(3-carboxypropoxy)phenyl]-2,3,22,24-tetrahydroporphyrin-5-yl]phenoxy]butanoic acid.
| Compound Name | 4-[3-[15-[3-(3-carboxypropoxy)phenyl]-2,3,22,24-tetrahydroporphyrin-5-yl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 155547569 |
| Molecular Formula | C40H36N4O6 |
| Molecular Weight | 668.75 g/mol |
| Exact Mass | 668.26 |
| IUPAC Name | 4-[3-[15-[3-(3-carboxypropoxy)phenyl]-2,3,22,24-tetrahydroporphyrin-5-yl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc(-c2c3nc(cc4ccc([nH]4)c(-c4cccc(OCCCC(=O)O)c4)c4nc(cc5ccc2[nH]5)CC4)C=C3)c1 |
| InChI | InChI=1S/C40H36N4O6/c45-37(46)9-3-19-49-31-7-1-5-25(21-31)39-33-15-11-27(41-33)23-29-13-17-35(43-29)40(26-6-2-8-32(22-26)50-20-4-10-38(47)48)36-18-14-30(44-36)24-28-12-16-34(39)42-28/h1-2,5-8,11-13,15-17,21-24,42-43H,3-4,9-10,14,18-20H2,(H,45,46)(H,47,48)/b27-23-,28-24-,29-23-,30-24-,39-33-,39-34-,40-35-,40-36- |
| InChIKey | UKDVAMUMIFPQEM-OXMALSCHSA-N |
| XLogP | 8.09 |
| TPSA | 150.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.75 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|