About N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide
N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 155547589) has the molecular formula C14H23N3O3
and a molecular weight of 281.36 g/mol. Its IUPAC name is N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide.
Molecular Properties
| Compound Name | N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| PubChem CID | 155547589 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | CCCCCCCCCNC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C14H23N3O3/c1-2-3-4-5-6-7-8-9-15-13(19)11-10-12(18)17-14(20)16-11/h10H,2-9H2,1H3,(H,15,19)(H2,16,17,18,20) |
| InChIKey | XUBKYUVTJDNCHI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The IUPAC name of N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide (CID 155547589) is N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide.
What is the SMILES notation for N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The canonical SMILES for N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide is CCCCCCCCCNC(=O)c1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide?
The InChIKey is XUBKYUVTJDNCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3/c1-2-3-4-5-6-7-8-9-15-13(19)11-10-12(18)17-14(20)16-11/h10H,2-9H2,1H3,(H,15,19)(H2,16,17,18,20).
What are the key properties of N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide?
N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide has a molecular weight of 281.36 g/mol, XLogP of 1.54, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-nonyl-2,4-dioxo-1H-pyrimidine-6-carboxamide is sourced from PubChem (CID 155547589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).