C8H11N2NaO6S — CID 155547636
sodium [(2S,5R)-2-(hydroxymethyl)-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate (PubChem CID 155547636) has the molecular formula C8H11N2NaO6S and a molecular weight of 286.24 g/mol. Its IUPAC name is sodium [(2S,5R)-2-(hydroxymethyl)-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-2-(hydroxymethyl)-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
|---|---|
| PubChem CID | 155547636 |
| Molecular Formula | C8H11N2NaO6S |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | sodium [(2S,5R)-2-(hydroxymethyl)-4-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
| SMILES | CC1=C[C@@H](CO)N2C[C@@H]1N(OS(=O)(=O)[O-])C2=O.[Na+] |
| InChI | InChI=1S/C8H12N2O6S.Na/c1-5-2-6(4-11)9-3-7(5)10(8(9)12)16-17(13,14)15;/h2,6-7,11H,3-4H2,1H3,(H,13,14,15);/q;+1/p-1/t6-,7-;/m0./s1 |
| InChIKey | BLTSVYVGKZBXFA-LEUCUCNGSA-M |
| XLogP | -4.19 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|