C19H18N2O4S — CID 155547724
3'-(4-methylphenyl)sulfonylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 155547724) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3'-(4-methylphenyl)sulfonylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-(4-methylphenyl)sulfonylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 155547724 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3'-(4-methylphenyl)sulfonylspiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)NC3(CCCc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-13-8-10-15(11-9-13)26(24,25)21-17(22)19(20-18(21)23)12-4-6-14-5-2-3-7-16(14)19/h2-3,5,7-11H,4,6,12H2,1H3,(H,20,23) |
| InChIKey | LXXQXOMQCGHKBG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|