About [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone
[3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone (PubChem CID 155547896) has the molecular formula C18H17ClN4O
and a molecular weight of 340.81 g/mol. Its IUPAC name is [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone |
| PubChem CID | 155547896 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCCC(c2cn3nc(Cl)ccc3n2)C1 |
| InChI | InChI=1S/C18H17ClN4O/c19-16-8-9-17-20-15(12-23(17)21-16)14-7-4-10-22(11-14)18(24)13-5-2-1-3-6-13/h1-3,5-6,8-9,12,14H,4,7,10-11H2 |
| InChIKey | JKGJSRZNHDGJCM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone?
The IUPAC name of [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone (CID 155547896) is [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone.
What is the SMILES notation for [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone?
The canonical SMILES for [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone is O=C(c1ccccc1)N1CCCC(c2cn3nc(Cl)ccc3n2)C1.
What is the InChIKey of [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone?
The InChIKey is JKGJSRZNHDGJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN4O/c19-16-8-9-17-20-15(12-23(17)21-16)14-7-4-10-22(11-14)18(24)13-5-2-1-3-6-13/h1-3,5-6,8-9,12,14H,4,7,10-11H2.
What are the key properties of [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone?
[3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone has a molecular weight of 340.81 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6-chloroimidazo[1,2-b]pyridazin-2-yl)piperidin-1-yl]-phenylmethanone is sourced from PubChem (CID 155547896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).