C36H43NO5S — CID 155547966
ethyl (1E)-2-[(8R,9S,13S,14S,17R)-17-hydroxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate (PubChem CID 155547966) has the molecular formula C36H43NO5S and a molecular weight of 601.81 g/mol. Its IUPAC name is ethyl (1E)-2-[(8R,9S,13S,14S,17R)-17-hydroxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate.
| Compound Name | ethyl (1E)-2-[(8R,9S,13S,14S,17R)-17-hydroxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate |
|---|---|
| PubChem CID | 155547966 |
| Molecular Formula | C36H43NO5S |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | ethyl (1E)-2-[(8R,9S,13S,14S,17R)-17-hydroxy-13-methyl-3-phenylmethoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-N-(4-methylphenyl)sulfonylethanimidate |
| SMILES | CCO/C(C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(OCc5ccccc5)ccc4[C@H]3CC[C@@]21C)=N/S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C36H43NO5S/c1-4-41-34(37-43(39,40)29-14-10-25(2)11-15-29)23-36(38)21-19-33-32-16-12-27-22-28(42-24-26-8-6-5-7-9-26)13-17-30(27)31(32)18-20-35(33,36)3/h5-11,13-15,17,22,31-33,38H,4,12,16,18-21,23-24H2,1-3H3/b37-34+/t31-,32-,33+,35+,36-/m1/s1 |
| InChIKey | XMEXATZBZPAZFR-OZKXJHTKSA-N |
| XLogP | 7.38 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|