About 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol
4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol (PubChem CID 155548288) has the molecular formula C24H21FN2O
and a molecular weight of 372.44 g/mol. Its IUPAC name is 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol.
Molecular Properties
| Compound Name | 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol |
| PubChem CID | 155548288 |
| Molecular Formula | C24H21FN2O |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol |
| SMILES | Oc1ccc(C2=CCCC[C@]23C=Cc2c(cnn2-c2ccc(F)cc2)C3)cc1 |
| InChI | InChI=1S/C24H21FN2O/c25-19-6-8-20(9-7-19)27-23-12-14-24(15-18(23)16-26-27)13-2-1-3-22(24)17-4-10-21(28)11-5-17/h3-12,14,16,28H,1-2,13,15H2/t24-/m1/s1 |
| InChIKey | FFKAKVHDQLARRR-XMMPIXPASA-N |
| XLogP | 5.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol?
The IUPAC name of 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol (CID 155548288) is 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol.
What is the SMILES notation for 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol?
The canonical SMILES for 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol is Oc1ccc(C2=CCCC[C@]23C=Cc2c(cnn2-c2ccc(F)cc2)C3)cc1.
What is the InChIKey of 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol?
The InChIKey is FFKAKVHDQLARRR-XMMPIXPASA-N. The full InChI is InChI=1S/C24H21FN2O/c25-19-6-8-20(9-7-19)27-23-12-14-24(15-18(23)16-26-27)13-2-1-3-22(24)17-4-10-21(28)11-5-17/h3-12,14,16,28H,1-2,13,15H2/t24-/m1/s1.
What are the key properties of 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol?
4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol has a molecular weight of 372.44 g/mol, XLogP of 5.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5S)-1-(4-fluorophenyl)spiro[4H-indazole-5,6'-cyclohexene]-1'-yl]phenol is sourced from PubChem (CID 155548288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).