C21H27NO — CID 155548394
7-(4-phenylbutylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ol (PubChem CID 155548394) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is 7-(4-phenylbutylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ol.
| Compound Name | 7-(4-phenylbutylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ol |
|---|---|
| PubChem CID | 155548394 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 7-(4-phenylbutylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-ol |
| SMILES | OC1CC(NCCCCc2ccccc2)CCc2ccccc21 |
| InChI | InChI=1S/C21H27NO/c23-21-16-19(14-13-18-11-4-5-12-20(18)21)22-15-7-6-10-17-8-2-1-3-9-17/h1-5,8-9,11-12,19,21-23H,6-7,10,13-16H2 |
| InChIKey | DATRPKNWOXENRL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|