C38H32I2N8O2 — CID 155548795
2-N,9-N-bis[(E)-(1-ethylquinolin-1-ium-6-yl)methylideneamino]-1,10-phenanthroline-2,9-dicarboxamide diiodide (PubChem CID 155548795) has the molecular formula C38H32I2N8O2 and a molecular weight of 886.54 g/mol. Its IUPAC name is 2-N,9-N-bis[(E)-(1-ethylquinolin-1-ium-6-yl)methylideneamino]-1,10-phenanthroline-2,9-dicarboxamide diiodide.
| Compound Name | 2-N,9-N-bis[(E)-(1-ethylquinolin-1-ium-6-yl)methylideneamino]-1,10-phenanthroline-2,9-dicarboxamide diiodide |
|---|---|
| PubChem CID | 155548795 |
| Molecular Formula | C38H32I2N8O2 |
| Molecular Weight | 886.54 g/mol |
| Exact Mass | 886.07 |
| IUPAC Name | 2-N,9-N-bis[(E)-(1-ethylquinolin-1-ium-6-yl)methylideneamino]-1,10-phenanthroline-2,9-dicarboxamide diiodide |
| SMILES | CC[n+]1cccc2cc(/C=N/NC(=O)c3ccc4ccc5ccc(C(=O)N/N=C/c6ccc7c(ccc[n+]7CC)c6)nc5c4n3)ccc21.[I-].[I-] |
| InChI | InChI=1S/C38H30N8O2.2HI/c1-3-45-19-5-7-29-21-25(9-17-33(29)45)23-39-43-37(47)31-15-13-27-11-12-28-14-16-32(42-36(28)35(27)41-31)38(48)44-40-24-26-10-18-34-30(22-26)8-6-20-46(34)4-2;;/h5-24H,3-4H2,1-2H3;2*1H/b39-23+,40-24+;; |
| InChIKey | AWLMLGMYHHUGQE-MBWRGRGVSA-N |
| XLogP | -0.76 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.54 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|