C30H37N7O — CID 155548847
4-(cyclohexylamino)-1-ethyl-N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 155548847) has the molecular formula C30H37N7O and a molecular weight of 511.67 g/mol. Its IUPAC name is 4-(cyclohexylamino)-1-ethyl-N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-(cyclohexylamino)-1-ethyl-N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 155548847 |
| Molecular Formula | C30H37N7O |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | 4-(cyclohexylamino)-1-ethyl-N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NC3CCCCC3)c(C(=O)NCCNc3c4c(nc5ccccc35)CCCC4)cnc21 |
| InChI | InChI=1S/C30H37N7O/c1-2-37-29-23(19-34-37)28(35-20-10-4-3-5-11-20)24(18-33-29)30(38)32-17-16-31-27-21-12-6-8-14-25(21)36-26-15-9-7-13-22(26)27/h6,8,12,14,18-20H,2-5,7,9-11,13,15-17H2,1H3,(H,31,36)(H,32,38)(H,33,35) |
| InChIKey | SBWPXDUGJRKADY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|