C34H35N3O5 — CID 155548878
benzyl N-[(2S)-1-[[(1S)-3-(benzylamino)-1-naphthalen-1-yl-2,3-dioxopropyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 155548878) has the molecular formula C34H35N3O5 and a molecular weight of 565.67 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(1S)-3-(benzylamino)-1-naphthalen-1-yl-2,3-dioxopropyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(1S)-3-(benzylamino)-1-naphthalen-1-yl-2,3-dioxopropyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 155548878 |
| Molecular Formula | C34H35N3O5 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | benzyl N-[(2S)-1-[[(1S)-3-(benzylamino)-1-naphthalen-1-yl-2,3-dioxopropyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](C(=O)C(=O)NCc1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C34H35N3O5/c1-23(2)20-29(36-34(41)42-22-25-14-7-4-8-15-25)32(39)37-30(28-19-11-17-26-16-9-10-18-27(26)28)31(38)33(40)35-21-24-12-5-3-6-13-24/h3-19,23,29-30H,20-22H2,1-2H3,(H,35,40)(H,36,41)(H,37,39)/t29-,30-/m0/s1 |
| InChIKey | JGQVPAZGBDAPMS-KYJUHHDHSA-N |
| XLogP | 5.22 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|