About 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium
5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium (PubChem CID 155548990) has the molecular formula C9H9FN2O2
and a molecular weight of 196.18 g/mol. Its IUPAC name is 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium.
Molecular Properties
| Compound Name | 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium |
| PubChem CID | 155548990 |
| Molecular Formula | C9H9FN2O2 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium |
| SMILES | CC1(C)[N+]([O-])=c2ccc(F)cc2=[N+]1[O-] |
| InChI | InChI=1S/C9H9FN2O2/c1-9(2)11(13)7-4-3-6(10)5-8(7)12(9)14/h3-5H,1-2H3 |
| InChIKey | JJBYHQBGGAABCR-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 52.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium?
The IUPAC name of 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium (CID 155548990) is 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium.
What is the SMILES notation for 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium?
The canonical SMILES for 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium is CC1(C)[N+]([O-])=c2ccc(F)cc2=[N+]1[O-].
What is the InChIKey of 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium?
The InChIKey is JJBYHQBGGAABCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2O2/c1-9(2)11(13)7-4-3-6(10)5-8(7)12(9)14/h3-5H,1-2H3.
What are the key properties of 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium?
5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium has a molecular weight of 196.18 g/mol, XLogP of -0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium is sourced from PubChem (CID 155548990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).