C11H11N3O3Se — CID 155548995
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)selenolan-2-yl]-5-ethynylimidazole-4-carbonitrile (PubChem CID 155548995) has the molecular formula C11H11N3O3Se and a molecular weight of 312.19 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)selenolan-2-yl]-5-ethynylimidazole-4-carbonitrile.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)selenolan-2-yl]-5-ethynylimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 155548995 |
| Molecular Formula | C11H11N3O3Se |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)selenolan-2-yl]-5-ethynylimidazole-4-carbonitrile |
| SMILES | C#Cc1c(C#N)ncn1[C@@H]1[Se][C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H11N3O3Se/c1-2-7-6(3-12)13-5-14(7)11-10(17)9(16)8(4-15)18-11/h1,5,8-11,15-17H,4H2/t8-,9-,10-,11-/m1/s1 |
| InChIKey | KCROUQJQEKKNCY-GWOFURMSSA-N |
| XLogP | -1.54 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|