About 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate
3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate (PubChem CID 155549050) has the molecular formula C21H19F2N3O2
and a molecular weight of 383.40 g/mol. Its IUPAC name is 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 155549050 |
| Molecular Formula | C21H19F2N3O2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OCCCc1cn(Cc2ccc(F)c(F)c2)nn1 |
| InChI | InChI=1S/C21H19F2N3O2/c22-19-10-8-17(13-20(19)23)14-26-15-18(24-25-26)7-4-12-28-21(27)11-9-16-5-2-1-3-6-16/h1-3,5-6,8-11,13,15H,4,7,12,14H2/b11-9+ |
| InChIKey | CDLCPCOGTWIUIX-PKNBQFBNSA-N |
| XLogP | 3.79 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate?
The IUPAC name of 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate (CID 155549050) is 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate is O=C(/C=C/c1ccccc1)OCCCc1cn(Cc2ccc(F)c(F)c2)nn1.
What is the InChIKey of 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate?
The InChIKey is CDLCPCOGTWIUIX-PKNBQFBNSA-N. The full InChI is InChI=1S/C21H19F2N3O2/c22-19-10-8-17(13-20(19)23)14-26-15-18(24-25-26)7-4-12-28-21(27)11-9-16-5-2-1-3-6-16/h1-3,5-6,8-11,13,15H,4,7,12,14H2/b11-9+.
What are the key properties of 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate?
3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate has a molecular weight of 383.40 g/mol, XLogP of 3.79, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[(3,4-difluorophenyl)methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 155549050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).