C28H22O6 — CID 155549180
(4bR,5R,9bR,10R)-5,10-bis(4-hydroxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene-2,4,7,9-tetrol (PubChem CID 155549180) has the molecular formula C28H22O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is (4bR,5R,9bR,10R)-5,10-bis(4-hydroxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene-2,4,7,9-tetrol.
| Compound Name | (4bR,5R,9bR,10R)-5,10-bis(4-hydroxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene-2,4,7,9-tetrol |
|---|---|
| PubChem CID | 155549180 |
| Molecular Formula | C28H22O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (4bR,5R,9bR,10R)-5,10-bis(4-hydroxyphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene-2,4,7,9-tetrol |
| SMILES | Oc1ccc([C@@H]2c3cc(O)cc(O)c3[C@H]3[C@H](c4ccc(O)cc4)c4cc(O)cc(O)c4[C@@H]23)cc1 |
| InChI | InChI=1S/C28H22O6/c29-15-5-1-13(2-6-15)23-19-9-17(31)11-21(33)25(19)28-24(14-3-7-16(30)8-4-14)20-10-18(32)12-22(34)26(20)27(23)28/h1-12,23-24,27-34H/t23-,24-,27-,28-/m1/s1 |
| InChIKey | FNDQTDQVYBBBQY-NFFAYCCRSA-N |
| XLogP | 5.08 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |