C13H17F2NO5 — CID 155549274
(2R,3R,4R,5R,6R)-4-(3,4-difluoroanilino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol (PubChem CID 155549274) has the molecular formula C13H17F2NO5 and a molecular weight of 305.28 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-4-(3,4-difluoroanilino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol.
| Compound Name | (2R,3R,4R,5R,6R)-4-(3,4-difluoroanilino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 155549274 |
| Molecular Formula | C13H17F2NO5 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (2R,3R,4R,5R,6R)-4-(3,4-difluoroanilino)-2-(hydroxymethyl)-6-methoxyoxane-3,5-diol |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O)[C@@H](Nc2ccc(F)c(F)c2)[C@H]1O |
| InChI | InChI=1S/C13H17F2NO5/c1-20-13-12(19)10(11(18)9(5-17)21-13)16-6-2-3-7(14)8(15)4-6/h2-4,9-13,16-19H,5H2,1H3/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | IFOPJPSUWILUOL-UJPOAAIJSA-N |
| XLogP | -0.17 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |