C25H25N5O4S2 — CID 155549386
2-methyl-N-[3-(4-naphthalen-1-ylsulfonylpiperazin-1-yl)pyrazin-2-yl]benzenesulfonamide (PubChem CID 155549386) has the molecular formula C25H25N5O4S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is 2-methyl-N-[3-(4-naphthalen-1-ylsulfonylpiperazin-1-yl)pyrazin-2-yl]benzenesulfonamide.
| Compound Name | 2-methyl-N-[3-(4-naphthalen-1-ylsulfonylpiperazin-1-yl)pyrazin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 155549386 |
| Molecular Formula | C25H25N5O4S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 2-methyl-N-[3-(4-naphthalen-1-ylsulfonylpiperazin-1-yl)pyrazin-2-yl]benzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1nccnc1N1CCN(S(=O)(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C25H25N5O4S2/c1-19-7-2-5-11-22(19)35(31,32)28-24-25(27-14-13-26-24)29-15-17-30(18-16-29)36(33,34)23-12-6-9-20-8-3-4-10-21(20)23/h2-14H,15-18H2,1H3,(H,26,28) |
| InChIKey | ZAZPAMMPHQPBOC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |