C33H32N6O6 — CID 155549411
17-[2-[2-[2-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methylamino]ethoxy]ethoxy]ethoxy]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-14-one (PubChem CID 155549411) has the molecular formula C33H32N6O6 and a molecular weight of 608.66 g/mol. Its IUPAC name is 17-[2-[2-[2-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methylamino]ethoxy]ethoxy]ethoxy]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-14-one.
| Compound Name | 17-[2-[2-[2-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methylamino]ethoxy]ethoxy]ethoxy]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-14-one |
|---|---|
| PubChem CID | 155549411 |
| Molecular Formula | C33H32N6O6 |
| Molecular Weight | 608.66 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 17-[2-[2-[2-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methylamino]ethoxy]ethoxy]ethoxy]-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,15(20),16,18-octaen-14-one |
| SMILES | O=c1c2cc(OCCOCCOCCNCc3c(-c4ccccc4)no[n+]3[O-])ccc2nc2n1CCc1c-2[nH]c2ccccc12 |
| InChI | InChI=1S/C33H32N6O6/c40-33-26-20-23(10-11-28(26)36-32-31-25(12-14-38(32)33)24-8-4-5-9-27(24)35-31)44-19-18-43-17-16-42-15-13-34-21-29-30(37-45-39(29)41)22-6-2-1-3-7-22/h1-11,20,34-35H,12-19,21H2 |
| InChIKey | UPYYJQUBVNHXTD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 143.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.66 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|