C14H29NO3 — CID 155549444
(2S,3R,4R,5R)-1-methyl-2-octylpiperidine-3,4,5-triol (PubChem CID 155549444) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is (2S,3R,4R,5R)-1-methyl-2-octylpiperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R)-1-methyl-2-octylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 155549444 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | (2S,3R,4R,5R)-1-methyl-2-octylpiperidine-3,4,5-triol |
| SMILES | CCCCCCCC[C@H]1[C@@H](O)[C@H](O)[C@H](O)CN1C |
| InChI | InChI=1S/C14H29NO3/c1-3-4-5-6-7-8-9-11-13(17)14(18)12(16)10-15(11)2/h11-14,16-18H,3-10H2,1-2H3/t11-,12+,13+,14+/m0/s1 |
| InChIKey | KHZBDDPHSPLJDP-REWJHTLYSA-N |
| XLogP | 1.13 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|