C20H20O5S — CID 155549446
[(1R,3R)-3-(4-oxobenzo[h]chromen-2-yl)cyclohexyl] methanesulfonate (PubChem CID 155549446) has the molecular formula C20H20O5S and a molecular weight of 372.44 g/mol. Its IUPAC name is [(1R,3R)-3-(4-oxobenzo[h]chromen-2-yl)cyclohexyl] methanesulfonate.
| Compound Name | [(1R,3R)-3-(4-oxobenzo[h]chromen-2-yl)cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 155549446 |
| Molecular Formula | C20H20O5S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [(1R,3R)-3-(4-oxobenzo[h]chromen-2-yl)cyclohexyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1CCC[C@@H](c2cc(=O)c3ccc4ccccc4c3o2)C1 |
| InChI | InChI=1S/C20H20O5S/c1-26(22,23)25-15-7-4-6-14(11-15)19-12-18(21)17-10-9-13-5-2-3-8-16(13)20(17)24-19/h2-3,5,8-10,12,14-15H,4,6-7,11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | PENHSPZKAODAGN-HUUCEWRRSA-N |
| XLogP | 3.95 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|