C23H24ClF3N2O4 — CID 155549510
9-[3-(4-chlorophenoxy)propyl]-8-methoxy-1,2,3,4-tetrahydropyrido[3,4-b]indole;2,2,2-trifluoroacetic acid (PubChem CID 155549510) has the molecular formula C23H24ClF3N2O4 and a molecular weight of 484.90 g/mol. Its IUPAC name is 9-[3-(4-chlorophenoxy)propyl]-8-methoxy-1,2,3,4-tetrahydropyrido[3,4-b]indole;2,2,2-trifluoroacetic acid.
| Compound Name | 9-[3-(4-chlorophenoxy)propyl]-8-methoxy-1,2,3,4-tetrahydropyrido[3,4-b]indole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155549510 |
| Molecular Formula | C23H24ClF3N2O4 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 9-[3-(4-chlorophenoxy)propyl]-8-methoxy-1,2,3,4-tetrahydropyrido[3,4-b]indole;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc2c3c(n(CCCOc4ccc(Cl)cc4)c12)CNCC3.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23ClN2O2.C2HF3O2/c1-25-20-5-2-4-18-17-10-11-23-14-19(17)24(21(18)20)12-3-13-26-16-8-6-15(22)7-9-16;3-2(4,5)1(6)7/h2,4-9,23H,3,10-14H2,1H3;(H,6,7) |
| InChIKey | GCRUPJOIKBOYRM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|