C16H14FN7O3S — CID 155549558
5-amino-N-[(E)-(4-fluorophenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 155549558) has the molecular formula C16H14FN7O3S and a molecular weight of 403.40 g/mol. Its IUPAC name is 5-amino-N-[(E)-(4-fluorophenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-amino-N-[(E)-(4-fluorophenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155549558 |
| Molecular Formula | C16H14FN7O3S |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 5-amino-N-[(E)-(4-fluorophenyl)methylideneamino]-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Nc1nc(C(=O)N/N=C/c2ccc(F)cc2)nn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H14FN7O3S/c17-11-3-1-10(2-4-11)9-20-22-15(25)14-21-16(18)24(23-14)12-5-7-13(8-6-12)28(19,26)27/h1-9H,(H,22,25)(H2,18,21,23)(H2,19,26,27)/b20-9+ |
| InChIKey | BYMPLOLXBMGRPW-AWQFTUOYSA-N |
| XLogP | 0.40 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|