About 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol
1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol (PubChem CID 155549658) has the molecular formula C20H27N3O
and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol |
| PubChem CID | 155549658 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol |
| SMILES | CNCC(O)CN1CCc2c(cccc2NCc2ccccc2)C1 |
| InChI | InChI=1S/C20H27N3O/c1-21-13-18(24)15-23-11-10-19-17(14-23)8-5-9-20(19)22-12-16-6-3-2-4-7-16/h2-9,18,21-22,24H,10-15H2,1H3 |
| InChIKey | YRUYMMWXYZARMX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol?
The IUPAC name of 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol (CID 155549658) is 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol.
What is the SMILES notation for 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol?
The canonical SMILES for 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol is CNCC(O)CN1CCc2c(cccc2NCc2ccccc2)C1.
What is the InChIKey of 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol?
The InChIKey is YRUYMMWXYZARMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O/c1-21-13-18(24)15-23-11-10-19-17(14-23)8-5-9-20(19)22-12-16-6-3-2-4-7-16/h2-9,18,21-22,24H,10-15H2,1H3.
What are the key properties of 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol?
1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol has a molecular weight of 325.46 g/mol, XLogP of 2.24, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(benzylamino)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(methylamino)propan-2-ol is sourced from PubChem (CID 155549658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).