About (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate
(1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate (PubChem CID 155549890) has the molecular formula C22H28N2O3
and a molecular weight of 368.48 g/mol. Its IUPAC name is (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate.
Molecular Properties
| Compound Name | (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate |
| PubChem CID | 155549890 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate |
| SMILES | COc1ccc(CCN(C(=O)OC2CCCN(C)C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N2O3/c1-23-15-6-9-21(17-23)27-22(25)24(19-7-4-3-5-8-19)16-14-18-10-12-20(26-2)13-11-18/h3-5,7-8,10-13,21H,6,9,14-17H2,1-2H3 |
| InChIKey | BHZGFEFKRNVCQX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate?
The IUPAC name of (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate (CID 155549890) is (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate.
What is the SMILES notation for (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate?
The canonical SMILES for (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate is COc1ccc(CCN(C(=O)OC2CCCN(C)C2)c2ccccc2)cc1.
What is the InChIKey of (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate?
The InChIKey is BHZGFEFKRNVCQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O3/c1-23-15-6-9-21(17-23)27-22(25)24(19-7-4-3-5-8-19)16-14-18-10-12-20(26-2)13-11-18/h3-5,7-8,10-13,21H,6,9,14-17H2,1-2H3.
What are the key properties of (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate?
(1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate has a molecular weight of 368.48 g/mol, XLogP of 3.98, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-3-yl) N-[2-(4-methoxyphenyl)ethyl]-N-phenylcarbamate is sourced from PubChem (CID 155549890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).