C25H35N3O4 — CID 155549915
[(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine;1H-imidazole-4,5-dicarboxylic acid (PubChem CID 155549915) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine;1H-imidazole-4,5-dicarboxylic acid.
| Compound Name | [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine;1H-imidazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 155549915 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine;1H-imidazole-4,5-dicarboxylic acid |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@](C)(CN)CCC[C@]21C.O=C(O)c1nc[nH]c1C(=O)O |
| InChI | InChI=1S/C20H31N.C5H4N2O4/c1-14(2)15-6-8-17-16(12-15)7-9-18-19(3,13-21)10-5-11-20(17,18)4;8-4(9)2-3(5(10)11)7-1-6-2/h6,8,12,14,18H,5,7,9-11,13,21H2,1-4H3;1H,(H,6,7)(H,8,9)(H,10,11)/t18-,19-,20+;/m0./s1 |
| InChIKey | LCHDUQGXSNVFSL-WFBUOHSLSA-N |
| XLogP | 4.59 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |