C13H16IN5O2 — CID 155549960
(1R,2S,3R,4R,5S)-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-(aminomethyl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 155549960) has the molecular formula C13H16IN5O2 and a molecular weight of 401.21 g/mol. Its IUPAC name is (1R,2S,3R,4R,5S)-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-(aminomethyl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2S,3R,4R,5S)-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-(aminomethyl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 155549960 |
| Molecular Formula | C13H16IN5O2 |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | (1R,2S,3R,4R,5S)-1-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-4-(aminomethyl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | NC[C@@H]1[C@@H](O)[C@@H](O)[C@@]2(n3cc(I)c4c(N)ncnc43)C[C@@H]12 |
| InChI | InChI=1S/C13H16IN5O2/c14-7-3-19(12-8(7)11(16)17-4-18-12)13-1-6(13)5(2-15)9(20)10(13)21/h3-6,9-10,20-21H,1-2,15H2,(H2,16,17,18)/t5-,6-,9+,10+,13+/m0/s1 |
| InChIKey | JPAKKFRFVDYXIO-KTCMLSIRSA-N |
| XLogP | -0.36 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|