C27H38O8 — CID 155550020
[(1S,3R,5R)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] propanoate (PubChem CID 155550020) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is [(1S,3R,5R)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] propanoate.
| Compound Name | [(1S,3R,5R)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] propanoate |
|---|---|
| PubChem CID | 155550020 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [(1S,3R,5R)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] propanoate |
| SMILES | C=CC(=C)CCC1(C)C(C)CC(O)C23C(=C[C@H](OC(=O)CC)CC12)[C@@H](OC(C)=O)O[C@H]3OC(C)=O |
| InChI | InChI=1S/C27H38O8/c1-8-15(3)10-11-26(7)16(4)12-22(30)27-20(13-19(14-21(26)27)34-23(31)9-2)24(32-17(5)28)35-25(27)33-18(6)29/h8,13,16,19,21-22,24-25,30H,1,3,9-12,14H2,2,4-7H3/t16?,19-,21?,22?,24-,25+,26?,27?/m0/s1 |
| InChIKey | NJOZTRHBLQOIOT-GFXJXTHCSA-N |
| XLogP | 3.98 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|