C24H23N5O5S — CID 155550304
N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide (PubChem CID 155550304) has the molecular formula C24H23N5O5S and a molecular weight of 493.55 g/mol. Its IUPAC name is N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide.
| Compound Name | N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 155550304 |
| Molecular Formula | C24H23N5O5S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(-c2cnc3[nH]ccc3c2)cc1)NCCNS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23N5O5S/c30-23(25-12-13-28-35(33,34)22-3-1-2-21(15-22)29(31)32)9-6-17-4-7-18(8-5-17)20-14-19-10-11-26-24(19)27-16-20/h1-5,7-8,10-11,14-16,28H,6,9,12-13H2,(H,25,30)(H,26,27) |
| InChIKey | MBGIPXRGJFFVJR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 147.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|