C24H19F2N3O5S — CID 155550370
N-[4-[1-[2-(2,4-difluorophenyl)-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]benzenesulfonamide (PubChem CID 155550370) has the molecular formula C24H19F2N3O5S and a molecular weight of 499.50 g/mol. Its IUPAC name is N-[4-[1-[2-(2,4-difluorophenyl)-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[1-[2-(2,4-difluorophenyl)-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155550370 |
| Molecular Formula | C24H19F2N3O5S |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-[4-[1-[2-(2,4-difluorophenyl)-2-oxoethyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]benzenesulfonamide |
| SMILES | CC1(c2ccc(NS(=O)(=O)c3ccccc3)cc2)NC(=O)N(CC(=O)c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C24H19F2N3O5S/c1-24(15-7-10-17(11-8-15)28-35(33,34)18-5-3-2-4-6-18)22(31)29(23(32)27-24)14-21(30)19-12-9-16(25)13-20(19)26/h2-13,28H,14H2,1H3,(H,27,32) |
| InChIKey | POLZCYZUTQTPRN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|