About 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine
6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine (PubChem CID 155550553) has the molecular formula C21H19N3O3
and a molecular weight of 361.40 g/mol. Its IUPAC name is 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine |
| PubChem CID | 155550553 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine |
| SMILES | COc1ccc(-c2cnc3cnc(-c4cc(OC)cc(OC)c4)cn23)cc1 |
| InChI | InChI=1S/C21H19N3O3/c1-25-16-6-4-14(5-7-16)20-11-23-21-12-22-19(13-24(20)21)15-8-17(26-2)10-18(9-15)27-3/h4-13H,1-3H3 |
| InChIKey | WHCWYIFNZAKUBS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine?
The IUPAC name of 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine (CID 155550553) is 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine.
What is the SMILES notation for 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine?
The canonical SMILES for 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine is COc1ccc(-c2cnc3cnc(-c4cc(OC)cc(OC)c4)cn23)cc1.
What is the InChIKey of 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine?
The InChIKey is WHCWYIFNZAKUBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O3/c1-25-16-6-4-14(5-7-16)20-11-23-21-12-22-19(13-24(20)21)15-8-17(26-2)10-18(9-15)27-3/h4-13H,1-3H3.
What are the key properties of 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine?
6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine has a molecular weight of 361.40 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethoxyphenyl)-3-(4-methoxyphenyl)imidazo[1,2-a]pyrazine is sourced from PubChem (CID 155550553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).