C39H32N4O — CID 155550604
(2E,7E)-2,7-bis[(1,3-diphenylpyrazol-4-yl)methylidene]cycloheptan-1-one (PubChem CID 155550604) has the molecular formula C39H32N4O and a molecular weight of 572.71 g/mol. Its IUPAC name is (2E,7E)-2,7-bis[(1,3-diphenylpyrazol-4-yl)methylidene]cycloheptan-1-one.
| Compound Name | (2E,7E)-2,7-bis[(1,3-diphenylpyrazol-4-yl)methylidene]cycloheptan-1-one |
|---|---|
| PubChem CID | 155550604 |
| Molecular Formula | C39H32N4O |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | (2E,7E)-2,7-bis[(1,3-diphenylpyrazol-4-yl)methylidene]cycloheptan-1-one |
| SMILES | O=C1/C(=C/c2cn(-c3ccccc3)nc2-c2ccccc2)CCCC/C1=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C39H32N4O/c44-39-31(25-33-27-42(35-21-9-3-10-22-35)40-37(33)29-15-5-1-6-16-29)19-13-14-20-32(39)26-34-28-43(36-23-11-4-12-24-36)41-38(34)30-17-7-2-8-18-30/h1-12,15-18,21-28H,13-14,19-20H2/b31-25+,32-26+ |
| InChIKey | WFSQZMIIRYMGBL-YESHOFFLSA-N |
| XLogP | 9.00 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|