C28H29F3O7S — CID 155550621
(4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-yl) 4-(trifluoromethoxy)benzenesulfonate (PubChem CID 155550621) has the molecular formula C28H29F3O7S and a molecular weight of 566.59 g/mol. Its IUPAC name is (4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-yl) 4-(trifluoromethoxy)benzenesulfonate.
| Compound Name | (4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-yl) 4-(trifluoromethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 155550621 |
| Molecular Formula | C28H29F3O7S |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | (4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-yl) 4-(trifluoromethoxy)benzenesulfonate |
| SMILES | COc1ccc2cc1Oc1cc(ccc1OC)CCC(OS(=O)(=O)c1ccc(OC(F)(F)F)cc1)CCCC2 |
| InChI | InChI=1S/C28H29F3O7S/c1-34-24-15-8-19-5-3-4-6-22(10-7-20-9-16-25(35-2)27(18-20)36-26(24)17-19)38-39(32,33)23-13-11-21(12-14-23)37-28(29,30)31/h8-9,11-18,22H,3-7,10H2,1-2H3 |
| InChIKey | UZUHPQHOVCJWIV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|