About 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline
3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline (PubChem CID 155550651) has the molecular formula C19H14N4O2
and a molecular weight of 330.35 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline.
Molecular Properties
| Compound Name | 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline |
| PubChem CID | 155550651 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline |
| SMILES | Nc1cccc(-c2cn3c(-c4ccc5c(c4)OCO5)cnc3cn2)c1 |
| InChI | InChI=1S/C19H14N4O2/c20-14-3-1-2-12(6-14)15-10-23-16(8-22-19(23)9-21-15)13-4-5-17-18(7-13)25-11-24-17/h1-10H,11,20H2 |
| InChIKey | WXJQLUXOZCDXBL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline?
The IUPAC name of 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline (CID 155550651) is 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline.
What is the SMILES notation for 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline?
The canonical SMILES for 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline is Nc1cccc(-c2cn3c(-c4ccc5c(c4)OCO5)cnc3cn2)c1.
What is the InChIKey of 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline?
The InChIKey is WXJQLUXOZCDXBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4O2/c20-14-3-1-2-12(6-14)15-10-23-16(8-22-19(23)9-21-15)13-4-5-17-18(7-13)25-11-24-17/h1-10H,11,20H2.
What are the key properties of 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline?
3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline has a molecular weight of 330.35 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1,3-benzodioxol-5-yl)imidazo[1,2-a]pyrazin-6-yl]aniline is sourced from PubChem (CID 155550651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).