C31H38O8 — CID 155550684
[(1R,3E,5R,7S,9R,11R,12R,13S,14S)-1,11-diacetyloxy-9-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] benzoate (PubChem CID 155550684) has the molecular formula C31H38O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is [(1R,3E,5R,7S,9R,11R,12R,13S,14S)-1,11-diacetyloxy-9-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] benzoate.
| Compound Name | [(1R,3E,5R,7S,9R,11R,12R,13S,14S)-1,11-diacetyloxy-9-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] benzoate |
|---|---|
| PubChem CID | 155550684 |
| Molecular Formula | C31H38O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [(1R,3E,5R,7S,9R,11R,12R,13S,14S)-1,11-diacetyloxy-9-hydroxy-3,6,6,14-tetramethyl-10-methylidene-2-oxo-13-tricyclo[10.3.0.05,7]pentadec-3-enyl] benzoate |
| SMILES | C=C1[C@H](O)C[C@H]2[C@@H](/C=C(\C)C(=O)[C@@]3(OC(C)=O)C[C@H](C)[C@H](OC(=O)c4ccccc4)[C@@H]3[C@H]1OC(C)=O)C2(C)C |
| InChI | InChI=1S/C31H38O8/c1-16-13-22-23(30(22,6)7)14-24(34)18(3)27(37-19(4)32)25-26(38-29(36)21-11-9-8-10-12-21)17(2)15-31(25,28(16)35)39-20(5)33/h8-13,17,22-27,34H,3,14-15H2,1-2,4-7H3/b16-13+/t17-,22+,23-,24+,25+,26-,27-,31+/m0/s1 |
| InChIKey | FFMFBMDSPOUUJB-KORXBCNZSA-N |
| XLogP | 4.21 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|