C23H15FN4O2S — CID 155550722
(5E)-5-[[4-[4-(4-fluoroanilino)pyrrolo[2,3-b]pyridin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 155550722) has the molecular formula C23H15FN4O2S and a molecular weight of 430.46 g/mol. Its IUPAC name is (5E)-5-[[4-[4-(4-fluoroanilino)pyrrolo[2,3-b]pyridin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[4-(4-fluoroanilino)pyrrolo[2,3-b]pyridin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 155550722 |
| Molecular Formula | C23H15FN4O2S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | (5E)-5-[[4-[4-(4-fluoroanilino)pyrrolo[2,3-b]pyridin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc(-n3ccc4c(Nc5ccc(F)cc5)ccnc43)cc2)S1 |
| InChI | InChI=1S/C23H15FN4O2S/c24-15-3-5-16(6-4-15)26-19-9-11-25-21-18(19)10-12-28(21)17-7-1-14(2-8-17)13-20-22(29)27-23(30)31-20/h1-13H,(H,25,26)(H,27,29,30)/b20-13+ |
| InChIKey | HIBYDAIXVMHDLP-DEDYPNTBSA-N |
| XLogP | 5.23 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|