C23H30O10 — CID 155550815
[(1S,3S,8R,10R,12S,16S)-5-(acetyloxymethyl)-16-hydroxy-8-methoxy-10-methyl-6-oxo-7,13,15-trioxatetracyclo[8.4.1.11,12.04,8]hexadec-4-en-3-yl] (E)-2-methylbut-2-enoate (PubChem CID 155550815) has the molecular formula C23H30O10 and a molecular weight of 466.48 g/mol. Its IUPAC name is [(1S,3S,8R,10R,12S,16S)-5-(acetyloxymethyl)-16-hydroxy-8-methoxy-10-methyl-6-oxo-7,13,15-trioxatetracyclo[8.4.1.11,12.04,8]hexadec-4-en-3-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1S,3S,8R,10R,12S,16S)-5-(acetyloxymethyl)-16-hydroxy-8-methoxy-10-methyl-6-oxo-7,13,15-trioxatetracyclo[8.4.1.11,12.04,8]hexadec-4-en-3-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 155550815 |
| Molecular Formula | C23H30O10 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [(1S,3S,8R,10R,12S,16S)-5-(acetyloxymethyl)-16-hydroxy-8-methoxy-10-methyl-6-oxo-7,13,15-trioxatetracyclo[8.4.1.11,12.04,8]hexadec-4-en-3-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C[C@@]23CO[C@@H](C[C@](C)(C[C@@]4(OC)OC(=O)C(COC(C)=O)=C14)O2)[C@@H]3O |
| InChI | InChI=1S/C23H30O10/c1-6-12(2)19(26)31-15-8-22-11-30-16(18(22)25)7-21(4,33-22)10-23(28-5)17(15)14(20(27)32-23)9-29-13(3)24/h6,15-16,18,25H,7-11H2,1-5H3/b12-6+/t15-,16-,18-,21+,22-,23+/m0/s1 |
| InChIKey | KZBZOIFZWRIHNJ-PPKIHHAFSA-N |
| XLogP | 1.09 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|