About 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine
5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine (PubChem CID 155550915) has the molecular formula C21H24N8
and a molecular weight of 388.48 g/mol. Its IUPAC name is 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine |
| PubChem CID | 155550915 |
| Molecular Formula | C21H24N8 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(N2CCN(c3cccc(-c4cnc(C5CC5)nc4)c3)CC2)c(N)n1 |
| InChI | InChI=1S/C21H24N8/c22-19-18(13-26-21(23)27-19)29-8-6-28(7-9-29)17-3-1-2-15(10-17)16-11-24-20(25-12-16)14-4-5-14/h1-3,10-14H,4-9H2,(H4,22,23,26,27) |
| InChIKey | XRRABFIIRGELKS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine?
The IUPAC name of 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine (CID 155550915) is 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine?
The canonical SMILES for 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine is Nc1ncc(N2CCN(c3cccc(-c4cnc(C5CC5)nc4)c3)CC2)c(N)n1.
What is the InChIKey of 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine?
The InChIKey is XRRABFIIRGELKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N8/c22-19-18(13-26-21(23)27-19)29-8-6-28(7-9-29)17-3-1-2-15(10-17)16-11-24-20(25-12-16)14-4-5-14/h1-3,10-14H,4-9H2,(H4,22,23,26,27).
What are the key properties of 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine?
5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine has a molecular weight of 388.48 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[3-(2-cyclopropylpyrimidin-5-yl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine is sourced from PubChem (CID 155550915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).