C14H14F3IN2O2 — CID 155551147
(2S)-N-[[2-iodo-3-(trifluoromethyl)phenyl]methyl]-1-methyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 155551147) has the molecular formula C14H14F3IN2O2 and a molecular weight of 426.18 g/mol. Its IUPAC name is (2S)-N-[[2-iodo-3-(trifluoromethyl)phenyl]methyl]-1-methyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[2-iodo-3-(trifluoromethyl)phenyl]methyl]-1-methyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155551147 |
| Molecular Formula | C14H14F3IN2O2 |
| Molecular Weight | 426.18 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | (2S)-N-[[2-iodo-3-(trifluoromethyl)phenyl]methyl]-1-methyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | CN1C(=O)CC[C@H]1C(=O)NCc1cccc(C(F)(F)F)c1I |
| InChI | InChI=1S/C14H14F3IN2O2/c1-20-10(5-6-11(20)21)13(22)19-7-8-3-2-4-9(12(8)18)14(15,16)17/h2-4,10H,5-7H2,1H3,(H,19,22)/t10-/m0/s1 |
| InChIKey | KIVRPCQQDABUOC-JTQLQIEISA-N |
| XLogP | 2.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|