C22H16F3N5OS — CID 155551158
4-[6-(1-methylindol-6-yl)pyrazolo[1,5-a]pyrimidin-3-yl]-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide (PubChem CID 155551158) has the molecular formula C22H16F3N5OS and a molecular weight of 455.47 g/mol. Its IUPAC name is 4-[6-(1-methylindol-6-yl)pyrazolo[1,5-a]pyrimidin-3-yl]-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide.
| Compound Name | 4-[6-(1-methylindol-6-yl)pyrazolo[1,5-a]pyrimidin-3-yl]-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 155551158 |
| Molecular Formula | C22H16F3N5OS |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 4-[6-(1-methylindol-6-yl)pyrazolo[1,5-a]pyrimidin-3-yl]-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
| SMILES | Cn1ccc2ccc(-c3cnc4c(-c5csc(C(=O)NCC(F)(F)F)c5)cnn4c3)cc21 |
| InChI | InChI=1S/C22H16F3N5OS/c1-29-5-4-13-2-3-14(6-18(13)29)16-8-26-20-17(9-28-30(20)10-16)15-7-19(32-11-15)21(31)27-12-22(23,24)25/h2-11H,12H2,1H3,(H,27,31) |
| InChIKey | FJGCZPIXTJBNIZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|