C30H35N7O2 — CID 155551163
1-[(1S,3aR,9bS)-3-(2-methoxyethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-1-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea (PubChem CID 155551163) has the molecular formula C30H35N7O2 and a molecular weight of 525.66 g/mol. Its IUPAC name is 1-[(1S,3aR,9bS)-3-(2-methoxyethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-1-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[(1S,3aR,9bS)-3-(2-methoxyethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-1-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 155551163 |
| Molecular Formula | C30H35N7O2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 1-[(1S,3aR,9bS)-3-(2-methoxyethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-1-yl]-3-[4-methyl-3-(1-methylpyrazol-4-yl)-1-phenylpyrazol-5-yl]urea |
| SMILES | COCCN1C[C@@H](NC(=O)Nc2c(C)c(-c3cnn(C)c3)nn2-c2ccccc2)[C@@H]2c3ccccc3CC[C@H]21 |
| InChI | InChI=1S/C30H35N7O2/c1-20-28(22-17-31-35(2)18-22)34-37(23-10-5-4-6-11-23)29(20)33-30(38)32-25-19-36(15-16-39-3)26-14-13-21-9-7-8-12-24(21)27(25)26/h4-12,17-18,25-27H,13-16,19H2,1-3H3,(H2,32,33,38)/t25-,26-,27+/m1/s1 |
| InChIKey | PGEFDDKLDARFGQ-PFBJBMPXSA-N |
| XLogP | 4.13 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |