C37H31N5O — CID 155551194
2-[4-[bis(1,2-dimethylindol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole (PubChem CID 155551194) has the molecular formula C37H31N5O and a molecular weight of 561.69 g/mol. Its IUPAC name is 2-[4-[bis(1,2-dimethylindol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-[bis(1,2-dimethylindol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 155551194 |
| Molecular Formula | C37H31N5O |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 2-[4-[bis(1,2-dimethylindol-3-yl)methyl]phenyl]-5-(1H-indol-3-yl)-1,3,4-oxadiazole |
| SMILES | Cc1c(C(c2ccc(-c3nnc(-c4c[nH]c5ccccc45)o3)cc2)c2c(C)n(C)c3ccccc23)c2ccccc2n1C |
| InChI | InChI=1S/C37H31N5O/c1-22-33(27-12-6-9-15-31(27)41(22)3)35(34-23(2)42(4)32-16-10-7-13-28(32)34)24-17-19-25(20-18-24)36-39-40-37(43-36)29-21-38-30-14-8-5-11-26(29)30/h5-21,35,38H,1-4H3 |
| InChIKey | GMBHGJNTCKAZCW-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|