C31H36N4O5 — CID 155551329
(3S)-N-benzyl-3-[[(2S)-3-cyclobutyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide (PubChem CID 155551329) has the molecular formula C31H36N4O5 and a molecular weight of 544.65 g/mol. Its IUPAC name is (3S)-N-benzyl-3-[[(2S)-3-cyclobutyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide.
| Compound Name | (3S)-N-benzyl-3-[[(2S)-3-cyclobutyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 155551329 |
| Molecular Formula | C31H36N4O5 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | (3S)-N-benzyl-3-[[(2S)-3-cyclobutyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@@H](CC1CCC1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C31H36N4O5/c36-27(15-14-21-8-3-1-4-9-21)34-26(18-22-12-7-13-22)30(39)35-25(19-24-16-17-32-29(24)38)28(37)31(40)33-20-23-10-5-2-6-11-23/h1-6,8-11,14-15,22,24-26H,7,12-13,16-20H2,(H,32,38)(H,33,40)(H,34,36)(H,35,39)/b15-14+/t24-,25-,26-/m0/s1 |
| InChIKey | LQKAIOZBOFRPLI-LCSMTBIFSA-N |
| XLogP | 2.27 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|