C14H20N6O4 — CID 155551387
1-[5-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)pentyl]-N-hydroxy-1,2,4-triazole-3-carboxamide (PubChem CID 155551387) has the molecular formula C14H20N6O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-[5-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)pentyl]-N-hydroxy-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[5-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)pentyl]-N-hydroxy-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155551387 |
| Molecular Formula | C14H20N6O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-[5-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)pentyl]-N-hydroxy-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cc(=O)n(C)c(=O)n1CCCCCn1cnc(C(=O)NO)n1 |
| InChI | InChI=1S/C14H20N6O4/c1-10-8-11(21)18(2)14(23)20(10)7-5-3-4-6-19-9-15-12(16-19)13(22)17-24/h8-9,24H,3-7H2,1-2H3,(H,17,22) |
| InChIKey | XFBLGDNJQFJJID-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|