C22H23N3O2 — CID 155551400
1-benzyl-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxamide (PubChem CID 155551400) has the molecular formula C22H23N3O2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-benzyl-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxamide.
| Compound Name | 1-benzyl-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 155551400 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-benzyl-2,6-dimethyl-4-phenyl-4H-pyridine-3,5-dicarboxamide |
| SMILES | CC1=C(C(N)=O)C(c2ccccc2)C(C(N)=O)=C(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H23N3O2/c1-14-18(21(23)26)20(17-11-7-4-8-12-17)19(22(24)27)15(2)25(14)13-16-9-5-3-6-10-16/h3-12,20H,13H2,1-2H3,(H2,23,26)(H2,24,27) |
| InChIKey | GSMXQPCCVIDHTD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |