C23H21F6NO2 — CID 155551419
5-[3-[4-[3,5-bis(trifluoromethyl)phenyl]-2,6-dimethylphenoxy]propyl]-3-methyl-1,2-oxazole (PubChem CID 155551419) has the molecular formula C23H21F6NO2 and a molecular weight of 457.41 g/mol. Its IUPAC name is 5-[3-[4-[3,5-bis(trifluoromethyl)phenyl]-2,6-dimethylphenoxy]propyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[3-[4-[3,5-bis(trifluoromethyl)phenyl]-2,6-dimethylphenoxy]propyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 155551419 |
| Molecular Formula | C23H21F6NO2 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 5-[3-[4-[3,5-bis(trifluoromethyl)phenyl]-2,6-dimethylphenoxy]propyl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(CCCOc2c(C)cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2C)on1 |
| InChI | InChI=1S/C23H21F6NO2/c1-13-7-16(17-10-18(22(24,25)26)12-19(11-17)23(27,28)29)8-14(2)21(13)31-6-4-5-20-9-15(3)30-32-20/h7-12H,4-6H2,1-3H3 |
| InChIKey | NFXIPCFDOOGZEA-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|