C19H24N6O2 — CID 155551465
(3R,5S)-5-[[(2E)-2-[[2-(benzylamino)pyrimidin-5-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid (PubChem CID 155551465) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (3R,5S)-5-[[(2E)-2-[[2-(benzylamino)pyrimidin-5-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-5-[[(2E)-2-[[2-(benzylamino)pyrimidin-5-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155551465 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (3R,5S)-5-[[(2E)-2-[[2-(benzylamino)pyrimidin-5-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CNC[C@@H](CN/N=C/c2cnc(NCc3ccccc3)nc2)C1 |
| InChI | InChI=1S/C19H24N6O2/c26-18(27)17-6-15(7-20-13-17)11-24-25-12-16-9-22-19(23-10-16)21-8-14-4-2-1-3-5-14/h1-5,9-10,12,15,17,20,24H,6-8,11,13H2,(H,26,27)(H,21,22,23)/b25-12+/t15-,17+/m0/s1 |
| InChIKey | YAITTYULMAIWAL-LMJLMGRBSA-N |
| XLogP | 1.32 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|